C22H19FN8O — CID 138466929
2-[(1S)-1-amino-1-(7H-purin-6-ylamino)propyl]-5-fluoro-3-phenylquinazolin-4-one (PubChem CID 138466929) has the molecular formula C22H19FN8O and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-[(1S)-1-amino-1-(7H-purin-6-ylamino)propyl]-5-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[(1S)-1-amino-1-(7H-purin-6-ylamino)propyl]-5-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 138466929 |
| Molecular Formula | C22H19FN8O |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[(1S)-1-amino-1-(7H-purin-6-ylamino)propyl]-5-fluoro-3-phenylquinazolin-4-one |
| SMILES | CC[C@](N)(Nc1ncnc2nc[nH]c12)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H19FN8O/c1-2-22(24,30-19-17-18(26-11-25-17)27-12-28-19)21-29-15-10-6-9-14(23)16(15)20(32)31(21)13-7-4-3-5-8-13/h3-12H,2,24H2,1H3,(H2,25,26,27,28,30)/t22-/m0/s1 |
| InChIKey | AYAFYJSUDMKDDR-QFIPXVFZSA-N |
| XLogP | 2.82 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|