About ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine
ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine (PubChem CID 144835192) has the molecular formula C25H27FN6O
and a molecular weight of 446.53 g/mol. Its IUPAC name is ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine.
Molecular Properties
| Compound Name | ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine |
| PubChem CID | 144835192 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine |
| SMILES | CC.CCCc1cc2cccc(F)c2c(=O)n1-c1ccccc1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C18H16FNO.C5H5N5.C2H6/c1-2-7-15-12-13-8-6-11-16(19)17(13)18(21)20(15)14-9-4-3-5-10-14;6-4-3-5(9-1-7-3)10-2-8-4;1-2/h3-6,8-12H,2,7H2,1H3;1-2H,(H3,6,7,8,9,10);1-2H3 |
| InChIKey | VQQVAXIFHCVFJG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine?
The IUPAC name of ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine (CID 144835192) is ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine.
What is the SMILES notation for ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine?
The canonical SMILES for ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine is CC.CCCc1cc2cccc(F)c2c(=O)n1-c1ccccc1.Nc1ncnc2nc[nH]c12.
What is the InChIKey of ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine?
The InChIKey is VQQVAXIFHCVFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO.C5H5N5.C2H6/c1-2-7-15-12-13-8-6-11-16(19)17(13)18(21)20(15)14-9-4-3-5-10-14;6-4-3-5(9-1-7-3)10-2-8-4;1-2/h3-6,8-12H,2,7H2,1H3;1-2H,(H3,6,7,8,9,10);1-2H3.
What are the key properties of ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine?
ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine has a molecular weight of 446.53 g/mol, XLogP of 5.04, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-fluoro-2-phenyl-3-propylisoquinolin-1-one;7H-purin-6-amine is sourced from PubChem (CID 144835192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).