C23H19F3N6O — CID 144514682
3-ethyl-2-phenyl-8-(trifluoromethyl)isoquinolin-1-one;7H-purin-6-amine (PubChem CID 144514682) has the molecular formula C23H19F3N6O and a molecular weight of 452.44 g/mol. Its IUPAC name is 3-ethyl-2-phenyl-8-(trifluoromethyl)isoquinolin-1-one;7H-purin-6-amine.
| Compound Name | 3-ethyl-2-phenyl-8-(trifluoromethyl)isoquinolin-1-one;7H-purin-6-amine |
|---|---|
| PubChem CID | 144514682 |
| Molecular Formula | C23H19F3N6O |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3-ethyl-2-phenyl-8-(trifluoromethyl)isoquinolin-1-one;7H-purin-6-amine |
| SMILES | CCc1cc2cccc(C(F)(F)F)c2c(=O)n1-c1ccccc1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C18H14F3NO.C5H5N5/c1-2-13-11-12-7-6-10-15(18(19,20)21)16(12)17(23)22(13)14-8-4-3-5-9-14;6-4-3-5(9-1-7-3)10-2-8-4/h3-11H,2H2,1H3;1-2H,(H3,6,7,8,9,10) |
| InChIKey | MTVVKJAYLBSOTE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |