C22H18ClFN6O — CID 144620561
8-chloro-3-ethyl-2-phenylisoquinolin-1-one;2-fluoro-7H-purin-6-amine (PubChem CID 144620561) has the molecular formula C22H18ClFN6O and a molecular weight of 436.88 g/mol. Its IUPAC name is 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;2-fluoro-7H-purin-6-amine.
| Compound Name | 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;2-fluoro-7H-purin-6-amine |
|---|---|
| PubChem CID | 144620561 |
| Molecular Formula | C22H18ClFN6O |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 8-chloro-3-ethyl-2-phenylisoquinolin-1-one;2-fluoro-7H-purin-6-amine |
| SMILES | CCc1cc2cccc(Cl)c2c(=O)n1-c1ccccc1.Nc1nc(F)nc2nc[nH]c12 |
| InChI | InChI=1S/C17H14ClNO.C5H4FN5/c1-2-13-11-12-7-6-10-15(18)16(12)17(20)19(13)14-8-4-3-5-9-14;6-5-10-3(7)2-4(11-5)9-1-8-2/h3-11H,2H2,1H3;1H,(H3,7,8,9,10,11) |
| InChIKey | JLJBWUIQSZOKLC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |