About 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine
8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine (PubChem CID 144835466) has the molecular formula C22H16ClF3N6O
and a molecular weight of 472.86 g/mol. Its IUPAC name is 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine.
Molecular Properties
| Compound Name | 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine |
| PubChem CID | 144835466 |
| Molecular Formula | C22H16ClF3N6O |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine |
| SMILES | CCc1cc2ccc(F)c(Cl)c2c(=O)n1-c1cc(F)cc(F)c1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H11ClF3NO.C5H5N5/c1-2-12-5-9-3-4-14(21)16(18)15(9)17(23)22(12)13-7-10(19)6-11(20)8-13;6-4-3-5(9-1-7-3)10-2-8-4/h3-8H,2H2,1H3;1-2H,(H3,6,7,8,9,10) |
| InChIKey | ATRRZRBQHXFZOF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine?
The IUPAC name of 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine (CID 144835466) is 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine.
What is the SMILES notation for 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine?
The canonical SMILES for 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine is CCc1cc2ccc(F)c(Cl)c2c(=O)n1-c1cc(F)cc(F)c1.Nc1ncnc2nc[nH]c12.
What is the InChIKey of 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine?
The InChIKey is ATRRZRBQHXFZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClF3NO.C5H5N5/c1-2-12-5-9-3-4-14(21)16(18)15(9)17(23)22(12)13-7-10(19)6-11(20)8-13;6-4-3-5(9-1-7-3)10-2-8-4/h3-8H,2H2,1H3;1-2H,(H3,6,7,8,9,10).
What are the key properties of 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine?
8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine has a molecular weight of 472.86 g/mol, XLogP of 4.56, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-(3,5-difluorophenyl)-3-ethyl-7-fluoroisoquinolin-1-one;7H-purin-6-amine is sourced from PubChem (CID 144835466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).