C22H18F3N7O — CID 144835371
3-(3,5-difluorophenyl)-6-fluoro-2-propylquinazolin-4-one;7H-purin-6-amine (PubChem CID 144835371) has the molecular formula C22H18F3N7O and a molecular weight of 453.43 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-6-fluoro-2-propylquinazolin-4-one;7H-purin-6-amine.
| Compound Name | 3-(3,5-difluorophenyl)-6-fluoro-2-propylquinazolin-4-one;7H-purin-6-amine |
|---|---|
| PubChem CID | 144835371 |
| Molecular Formula | C22H18F3N7O |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-(3,5-difluorophenyl)-6-fluoro-2-propylquinazolin-4-one;7H-purin-6-amine |
| SMILES | CCCc1nc2ccc(F)cc2c(=O)n1-c1cc(F)cc(F)c1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H13F3N2O.C5H5N5/c1-2-3-16-21-15-5-4-10(18)9-14(15)17(23)22(16)13-7-11(19)6-12(20)8-13;6-4-3-5(9-1-7-3)10-2-8-4/h4-9H,2-3H2,1H3;1-2H,(H3,6,7,8,9,10) |
| InChIKey | ZPYGATSCLFFTIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |