C22H15ClF2N6O — CID 118044009
8-chloro-7-fluoro-2-(4-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 118044009) has the molecular formula C22H15ClF2N6O and a molecular weight of 452.85 g/mol. Its IUPAC name is 8-chloro-7-fluoro-2-(4-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-7-fluoro-2-(4-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 118044009 |
| Molecular Formula | C22H15ClF2N6O |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 8-chloro-7-fluoro-2-(4-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2ccc(F)c(Cl)c2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15ClF2N6O/c1-11(30-21-19-20(27-9-26-19)28-10-29-21)16-8-12-2-7-15(25)18(23)17(12)22(32)31(16)14-5-3-13(24)4-6-14/h2-11H,1H3,(H2,26,27,28,29,30) |
| InChIKey | LZVFZGREQCYQAY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |