C24H20N6O — CID 66615528
8-ethenyl-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 66615528) has the molecular formula C24H20N6O and a molecular weight of 408.47 g/mol. Its IUPAC name is 8-ethenyl-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-ethenyl-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 66615528 |
| Molecular Formula | C24H20N6O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 8-ethenyl-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | C=Cc1cccc2cc([C@@H](C)Nc3ncnc4nc[nH]c34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C24H20N6O/c1-3-16-8-7-9-17-12-19(30(24(31)20(16)17)18-10-5-4-6-11-18)15(2)29-23-21-22(26-13-25-21)27-14-28-23/h3-15H,1H2,2H3,(H2,25,26,27,28,29)/t15-/m1/s1 |
| InChIKey | ACUYODADNCTAKQ-OAHLLOKOSA-N |
| XLogP | 4.47 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |