C26H22N8O — CID 66615563
8-(1-methylpyrazol-4-yl)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 66615563) has the molecular formula C26H22N8O and a molecular weight of 462.52 g/mol. Its IUPAC name is 8-(1-methylpyrazol-4-yl)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-(1-methylpyrazol-4-yl)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 66615563 |
| Molecular Formula | C26H22N8O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 8-(1-methylpyrazol-4-yl)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | C[C@@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(-c3cnn(C)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C26H22N8O/c1-16(32-25-23-24(28-14-27-23)29-15-30-25)21-11-17-7-6-10-20(18-12-31-33(2)13-18)22(17)26(35)34(21)19-8-4-3-5-9-19/h3-16H,1-2H3,(H2,27,28,29,30,32)/t16-/m1/s1 |
| InChIKey | QJWUOXZEZVGXSD-MRXNPFEDSA-N |
| XLogP | 4.23 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |