C25H20N8O — CID 77153722
2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-8-pyrazol-1-ylisoquinolin-1-one (PubChem CID 77153722) has the molecular formula C25H20N8O and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-8-pyrazol-1-ylisoquinolin-1-one.
| Compound Name | 2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-8-pyrazol-1-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 77153722 |
| Molecular Formula | C25H20N8O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-8-pyrazol-1-ylisoquinolin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(-n3cccn3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H20N8O/c1-16(31-24-22-23(27-14-26-22)28-15-29-24)20-13-17-7-5-10-19(32-12-6-11-30-32)21(17)25(34)33(20)18-8-3-2-4-9-18/h2-16H,1H3,(H2,26,27,28,29,31) |
| InChIKey | AAKXBEVPFWYZQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |