C27H27N7O2 — CID 66615572
8-(oxan-4-ylamino)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 66615572) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 8-(oxan-4-ylamino)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-(oxan-4-ylamino)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 66615572 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 8-(oxan-4-ylamino)-2-phenyl-3-[(1R)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | C[C@@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(NC3CCOCC3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C27H27N7O2/c1-17(32-26-24-25(29-15-28-24)30-16-31-26)22-14-18-6-5-9-21(33-19-10-12-36-13-11-19)23(18)27(35)34(22)20-7-3-2-4-8-20/h2-9,14-17,19,33H,10-13H2,1H3,(H2,28,29,30,31,32)/t17-/m1/s1 |
| InChIKey | UGQCOFYFBZVKTD-QGZVFWFLSA-N |
| XLogP | 4.42 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |