C28H23N7O — CID 66615541
8-(2-methyl-4-pyridinyl)-2-phenyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 66615541) has the molecular formula C28H23N7O and a molecular weight of 473.54 g/mol. Its IUPAC name is 8-(2-methyl-4-pyridinyl)-2-phenyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-(2-methyl-4-pyridinyl)-2-phenyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 66615541 |
| Molecular Formula | C28H23N7O |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 8-(2-methyl-4-pyridinyl)-2-phenyl-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | Cc1cc(-c2cccc3cc([C@H](C)Nc4ncnc5nc[nH]c45)n(-c4ccccc4)c(=O)c23)ccn1 |
| InChI | InChI=1S/C28H23N7O/c1-17-13-19(11-12-29-17)22-10-6-7-20-14-23(35(28(36)24(20)22)21-8-4-3-5-9-21)18(2)34-27-25-26(31-15-30-25)32-16-33-27/h3-16,18H,1-2H3,(H2,30,31,32,33,34)/t18-/m0/s1 |
| InChIKey | HNSCHKTUMLUFDT-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |