C24H21ClN6O — CID 50905710
8-chloro-3-[(1S)-2-methyl-1-(7H-purin-6-ylamino)propyl]-2-phenylisoquinolin-1-one (PubChem CID 50905710) has the molecular formula C24H21ClN6O and a molecular weight of 444.93 g/mol. Its IUPAC name is 8-chloro-3-[(1S)-2-methyl-1-(7H-purin-6-ylamino)propyl]-2-phenylisoquinolin-1-one.
| Compound Name | 8-chloro-3-[(1S)-2-methyl-1-(7H-purin-6-ylamino)propyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 50905710 |
| Molecular Formula | C24H21ClN6O |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 8-chloro-3-[(1S)-2-methyl-1-(7H-purin-6-ylamino)propyl]-2-phenylisoquinolin-1-one |
| SMILES | CC(C)[C@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H21ClN6O/c1-14(2)20(30-23-21-22(27-12-26-21)28-13-29-23)18-11-15-7-6-10-17(25)19(15)24(32)31(18)16-8-4-3-5-9-16/h3-14,20H,1-2H3,(H2,26,27,28,29,30)/t20-/m0/s1 |
| InChIKey | RKMFIKGDNMFPTI-FQEVSTJZSA-N |
| XLogP | 5.12 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |