C23H21ClN6O — CID 126698387
8-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 126698387) has the molecular formula C23H21ClN6O and a molecular weight of 432.92 g/mol. Its IUPAC name is 8-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 126698387 |
| Molecular Formula | C23H21ClN6O |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 8-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-[(1S)-1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | C=C/C=C\C=C(/C)n1c([C@H](C)Nc2ncnc3nc[nH]c23)cc2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C23H21ClN6O/c1-4-5-6-8-14(2)30-18(11-16-9-7-10-17(24)19(16)23(30)31)15(3)29-22-20-21(26-12-25-20)27-13-28-22/h4-13,15H,1H2,2-3H3,(H2,25,26,27,28,29)/b6-5-,14-8+/t15-/m0/s1 |
| InChIKey | UZMXSWJRUNOEMA-HMWRZIPWSA-N |
| XLogP | 5.10 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|