C21H15ClFN7O — CID 118044016
8-chloro-2-(2-fluoro-3-pyridinyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 118044016) has the molecular formula C21H15ClFN7O and a molecular weight of 435.85 g/mol. Its IUPAC name is 8-chloro-2-(2-fluoro-3-pyridinyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-2-(2-fluoro-3-pyridinyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 118044016 |
| Molecular Formula | C21H15ClFN7O |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 8-chloro-2-(2-fluoro-3-pyridinyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2c(=O)n1-c1cccnc1F |
| InChI | InChI=1S/C21H15ClFN7O/c1-11(29-20-17-19(26-9-25-17)27-10-28-20)15-8-12-4-2-5-13(22)16(12)21(31)30(15)14-6-3-7-24-18(14)23/h2-11H,1H3,(H2,25,26,27,28,29) |
| InChIKey | VJUDULNXJWFCAR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|