C26H24FN7O3 — CID 57488700
6-fluoro-3-[3-(oxan-4-yloxy)phenyl]-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 57488700) has the molecular formula C26H24FN7O3 and a molecular weight of 501.52 g/mol. Its IUPAC name is 6-fluoro-3-[3-(oxan-4-yloxy)phenyl]-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 6-fluoro-3-[3-(oxan-4-yloxy)phenyl]-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 57488700 |
| Molecular Formula | C26H24FN7O3 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 6-fluoro-3-[3-(oxan-4-yloxy)phenyl]-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2ccc(F)cc2c(=O)n1-c1cccc(OC2CCOCC2)c1 |
| InChI | InChI=1S/C26H24FN7O3/c1-15(32-24-22-23(29-13-28-22)30-14-31-24)25-33-21-6-5-16(27)11-20(21)26(35)34(25)17-3-2-4-19(12-17)37-18-7-9-36-10-8-18/h2-6,11-15,18H,7-10H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | CJILTBVQEPXLIW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |