C23H18FN7O — CID 164626971
2-[(S)-cyclopropyl-(7H-purin-6-ylamino)methyl]-6-fluoro-3-phenylquinazolin-4-one (PubChem CID 164626971) has the molecular formula C23H18FN7O and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-[(S)-cyclopropyl-(7H-purin-6-ylamino)methyl]-6-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[(S)-cyclopropyl-(7H-purin-6-ylamino)methyl]-6-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 164626971 |
| Molecular Formula | C23H18FN7O |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(S)-cyclopropyl-(7H-purin-6-ylamino)methyl]-6-fluoro-3-phenylquinazolin-4-one |
| SMILES | O=c1c2cc(F)ccc2nc([C@@H](Nc2ncnc3nc[nH]c23)C2CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H18FN7O/c24-14-8-9-17-16(10-14)23(32)31(15-4-2-1-3-5-15)22(29-17)18(13-6-7-13)30-21-19-20(26-11-25-19)27-12-28-21/h1-5,8-13,18H,6-7H2,(H2,25,26,27,28,30)/t18-/m0/s1 |
| InChIKey | LMXZAHWOXLADSH-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |