C21H14FN7O — CID 166475293
6-fluoro-2-[C-methyl-N-(7H-purin-6-yl)carbonimidoyl]-3-phenylquinazolin-4-one (PubChem CID 166475293) has the molecular formula C21H14FN7O and a molecular weight of 399.39 g/mol. Its IUPAC name is 6-fluoro-2-[C-methyl-N-(7H-purin-6-yl)carbonimidoyl]-3-phenylquinazolin-4-one.
| Compound Name | 6-fluoro-2-[C-methyl-N-(7H-purin-6-yl)carbonimidoyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 166475293 |
| Molecular Formula | C21H14FN7O |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 6-fluoro-2-[C-methyl-N-(7H-purin-6-yl)carbonimidoyl]-3-phenylquinazolin-4-one |
| SMILES | C/C(=N\c1ncnc2nc[nH]c12)c1nc2ccc(F)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H14FN7O/c1-12(27-19-17-18(24-10-23-17)25-11-26-19)20-28-16-8-7-13(22)9-15(16)21(30)29(20)14-5-3-2-4-6-14/h2-11H,1H3,(H,23,24,25,26)/b27-12+ |
| InChIKey | UOKCHRMUOZJHON-KKMKTNMSSA-N |
| XLogP | 3.33 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|