C22H17ClFN7O — CID 118044338
5-chloro-6-fluoro-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (PubChem CID 118044338) has the molecular formula C22H17ClFN7O and a molecular weight of 449.88 g/mol. Its IUPAC name is 5-chloro-6-fluoro-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one.
| Compound Name | 5-chloro-6-fluoro-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 118044338 |
| Molecular Formula | C22H17ClFN7O |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-chloro-6-fluoro-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2ccc(F)c(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H17ClFN7O/c1-2-14(29-20-18-19(26-10-25-18)27-11-28-20)21-30-15-9-8-13(24)17(23)16(15)22(32)31(21)12-6-4-3-5-7-12/h3-11,14H,2H2,1H3,(H2,25,26,27,28,29)/t14-/m0/s1 |
| InChIKey | XWTDUVZYUVENAH-AWEZNQCLSA-N |
| XLogP | 4.41 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |