C23H20IN8O3- — CID 142506075
N-hydroxy-1-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]iodanuidylformamide (PubChem CID 142506075) has the molecular formula C23H20IN8O3- and a molecular weight of 583.37 g/mol. Its IUPAC name is N-hydroxy-1-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]iodanuidylformamide.
| Compound Name | N-hydroxy-1-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]iodanuidylformamide |
|---|---|
| PubChem CID | 142506075 |
| Molecular Formula | C23H20IN8O3- |
| Molecular Weight | 583.37 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | N-hydroxy-1-[4-oxo-3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]iodanuidylformamide |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc([I-]C(=O)NO)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20IN8O3/c1-2-15(29-20-18-19(26-11-25-18)27-12-28-20)21-30-16-10-6-9-14(24-23(34)31-35)17(16)22(33)32(21)13-7-4-3-5-8-13/h3-12,15,35H,2H2,1H3,(H,31,34)(H2,25,26,27,28,29)/q-1/t15-/m0/s1 |
| InChIKey | XVASVNYSMJNVQS-HNNXBMFYSA-N |
| XLogP | -0.03 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|