C28H26N10O3S — CID 137368145
N-hydroxy-2-[[[4-oxo-3-phenyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 137368145) has the molecular formula C28H26N10O3S and a molecular weight of 582.65 g/mol. Its IUPAC name is N-hydroxy-2-[[[4-oxo-3-phenyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-hydroxy-2-[[[4-oxo-3-phenyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137368145 |
| Molecular Formula | C28H26N10O3S |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | N-hydroxy-2-[[[4-oxo-3-phenyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(CNCc3nc(C(=O)NO)cs3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H26N10O3S/c1-2-18(35-25-23-24(31-14-30-23)32-15-33-25)26-36-19-10-6-7-16(11-29-12-21-34-20(13-42-21)27(39)37-41)22(19)28(40)38(26)17-8-4-3-5-9-17/h3-10,13-15,18,29,41H,2,11-12H2,1H3,(H,37,39)(H2,30,31,32,33,35) |
| InChIKey | ZTYRPSLCMNIDLW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 175.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|