C31H29N9O3 — CID 137368152
N-hydroxy-4-[[[4-oxo-3-phenyl-2-[3-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]benzamide (PubChem CID 137368152) has the molecular formula C31H29N9O3 and a molecular weight of 575.63 g/mol. Its IUPAC name is N-hydroxy-4-[[[4-oxo-3-phenyl-2-[3-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[[4-oxo-3-phenyl-2-[3-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 137368152 |
| Molecular Formula | C31H29N9O3 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | N-hydroxy-4-[[[4-oxo-3-phenyl-2-[3-(7H-purin-6-ylamino)propyl]quinazolin-5-yl]methylamino]methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CNCc2cccc3nc(CCCNc4ncnc5nc[nH]c45)n(-c4ccccc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C31H29N9O3/c41-30(39-43)21-13-11-20(12-14-21)16-32-17-22-6-4-9-24-26(22)31(42)40(23-7-2-1-3-8-23)25(38-24)10-5-15-33-28-27-29(35-18-34-27)37-19-36-28/h1-4,6-9,11-14,18-19,32,43H,5,10,15-17H2,(H,39,41)(H2,33,34,35,36,37) |
| InChIKey | OXHJCMZKUBSTEA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 162.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|