C27H27N3O3 — CID 137368180
methyl 4-[2-[2-(3-aminopropyl)-4-oxo-3-phenylquinazolin-5-yl]ethyl]benzoate (PubChem CID 137368180) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is methyl 4-[2-[2-(3-aminopropyl)-4-oxo-3-phenylquinazolin-5-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-(3-aminopropyl)-4-oxo-3-phenylquinazolin-5-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 137368180 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | methyl 4-[2-[2-(3-aminopropyl)-4-oxo-3-phenylquinazolin-5-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2cccc3nc(CCCN)n(-c4ccccc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-33-27(32)21-16-13-19(14-17-21)12-15-20-7-5-10-23-25(20)26(31)30(22-8-3-2-4-9-22)24(29-23)11-6-18-28/h2-5,7-10,13-14,16-17H,6,11-12,15,18,28H2,1H3 |
| InChIKey | RAUGELNRFQNOTD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |