C24H29N3O3 — CID 24989164
[4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]methyl N-tert-butylcarbamate (PubChem CID 24989164) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is [4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]methyl N-tert-butylcarbamate.
| Compound Name | [4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 24989164 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | [4-(2-butyl-4-oxoquinazolin-3-yl)phenyl]methyl N-tert-butylcarbamate |
| SMILES | CCCCc1nc2ccccc2c(=O)n1-c1ccc(COC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-5-6-11-21-25-20-10-8-7-9-19(20)22(28)27(21)18-14-12-17(13-15-18)16-30-23(29)26-24(2,3)4/h7-10,12-15H,5-6,11,16H2,1-4H3,(H,26,29) |
| InChIKey | DNSDPBCPKXFAJH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |