C20H21N3O — CID 24989172
2-butyl-3-(2,3-dihydro-1H-indol-5-yl)quinazolin-4-one (PubChem CID 24989172) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)quinazolin-4-one.
| Compound Name | 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 24989172 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-butyl-3-(2,3-dihydro-1H-indol-5-yl)quinazolin-4-one |
| SMILES | CCCCc1nc2ccccc2c(=O)n1-c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C20H21N3O/c1-2-3-8-19-22-18-7-5-4-6-16(18)20(24)23(19)15-9-10-17-14(13-15)11-12-21-17/h4-7,9-10,13,21H,2-3,8,11-12H2,1H3 |
| InChIKey | SLBVSAWHOIHARW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |