C18H16AsClN2O — CID 87756550
CID 87756550 (PubChem CID 87756550) has the molecular formula C18H16AsClN2O and a molecular weight of 386.71 g/mol.
| Compound Name | CID 87756550 |
|---|---|
| PubChem CID | 87756550 |
| Molecular Formula | C18H16AsClN2O |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | — |
| SMILES | CCCCc1nc2cc(Cl)ccc2c(=O)n1-c1ccc([As])cc1 |
| InChI | InChI=1S/C18H16AsClN2O/c1-2-3-4-17-21-16-11-13(20)7-10-15(16)18(23)22(17)14-8-5-12(19)6-9-14/h5-11H,2-4H2,1H3 |
| InChIKey | YVAWJDJBHRGOJY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|