C19H21ClN3O+ — CID 7493092
[(1S)-1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-ethylazanium (PubChem CID 7493092) has the molecular formula C19H21ClN3O+ and a molecular weight of 342.85 g/mol. Its IUPAC name is [(1S)-1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-ethylazanium.
| Compound Name | [(1S)-1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-ethylazanium |
|---|---|
| PubChem CID | 7493092 |
| Molecular Formula | C19H21ClN3O+ |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [(1S)-1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-ethylazanium |
| SMILES | CC[NH2+][C@@H](C)c1nc2cc(Cl)ccc2c(=O)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20ClN3O/c1-4-21-13(3)18-22-17-11-14(20)7-10-16(17)19(24)23(18)15-8-5-12(2)6-9-15/h5-11,13,21H,4H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | ZJJUMTFAXOWWGH-ZDUSSCGKSA-O |
| XLogP | 2.99 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |