C21H25ClN3O+ — CID 7201809
[(1R)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-pentylazanium (PubChem CID 7201809) has the molecular formula C21H25ClN3O+ and a molecular weight of 370.90 g/mol. Its IUPAC name is [(1R)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-pentylazanium.
| Compound Name | [(1R)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-pentylazanium |
|---|---|
| PubChem CID | 7201809 |
| Molecular Formula | C21H25ClN3O+ |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [(1R)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-pentylazanium |
| SMILES | CCCCC[NH2+][C@H](C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O/c1-3-4-7-14-23-15(2)20-24-19-9-6-5-8-18(19)21(26)25(20)17-12-10-16(22)11-13-17/h5-6,8-13,15,23H,3-4,7,14H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | UCDXNCYDYBCKQT-OAHLLOKOSA-O |
| XLogP | 3.85 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|