C21H25ClN3O+ — CID 7400132
[(1S)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(3-methylbutyl)azanium (PubChem CID 7400132) has the molecular formula C21H25ClN3O+ and a molecular weight of 370.90 g/mol. Its IUPAC name is [(1S)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(3-methylbutyl)azanium.
| Compound Name | [(1S)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(3-methylbutyl)azanium |
|---|---|
| PubChem CID | 7400132 |
| Molecular Formula | C21H25ClN3O+ |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [(1S)-1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(3-methylbutyl)azanium |
| SMILES | CC(C)CC[NH2+][C@@H](C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O/c1-14(2)12-13-23-15(3)20-24-19-7-5-4-6-18(19)21(26)25(20)17-10-8-16(22)9-11-17/h4-11,14-15,23H,12-13H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | MHJAZWZDJINJPC-HNNXBMFYSA-O |
| XLogP | 3.71 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |