C20H23ClN3O3+ — CID 7202114
[(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium (PubChem CID 7202114) has the molecular formula C20H23ClN3O3+ and a molecular weight of 388.88 g/mol. Its IUPAC name is [(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium.
| Compound Name | [(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7202114 |
| Molecular Formula | C20H23ClN3O3+ |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+][C@@H](C)c1nc2cc(Cl)ccc2c(=O)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-13(22-10-11-26-2)19-23-18-12-14(21)4-9-17(18)20(25)24(19)15-5-7-16(27-3)8-6-15/h4-9,12-13,22H,10-11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | VKAXEBQCMVBZNW-ZDUSSCGKSA-O |
| XLogP | 2.32 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|