C26H31Cl2N3O3 — CID 42718493
4-chloro-N-[1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)butanamide (PubChem CID 42718493) has the molecular formula C26H31Cl2N3O3 and a molecular weight of 504.46 g/mol. Its IUPAC name is 4-chloro-N-[1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)butanamide.
| Compound Name | 4-chloro-N-[1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)butanamide |
|---|---|
| PubChem CID | 42718493 |
| Molecular Formula | C26H31Cl2N3O3 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 4-chloro-N-[1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)butanamide |
| SMILES | COc1ccc(-n2c(C(C)N(CCC(C)C)C(=O)CCCCl)nc3cc(Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H31Cl2N3O3/c1-17(2)13-15-30(24(32)6-5-14-27)18(3)25-29-23-16-19(28)7-12-22(23)26(33)31(25)20-8-10-21(34-4)11-9-20/h7-12,16-18H,5-6,13-15H2,1-4H3 |
| InChIKey | HEIKUCCCMYFIOS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|