C24H27Cl2N3O2 — CID 5108411
2-chloro-N-[1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)acetamide (PubChem CID 5108411) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is 2-chloro-N-[1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-chloro-N-[1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 5108411 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-chloro-N-[1-[7-chloro-3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)acetamide |
| SMILES | Cc1ccc(-n2c(C(C)N(CCC(C)C)C(=O)CCl)nc3cc(Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-15(2)11-12-28(22(30)14-25)17(4)23-27-21-13-18(26)7-10-20(21)24(31)29(23)19-8-5-16(3)6-9-19/h5-10,13,15,17H,11-12,14H2,1-4H3 |
| InChIKey | YBOBAROGUALBNQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|