C29H30ClN3O2 — CID 42716765
N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-2-phenylacetamide (PubChem CID 42716765) has the molecular formula C29H30ClN3O2 and a molecular weight of 488.03 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-2-phenylacetamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 42716765 |
| Molecular Formula | C29H30ClN3O2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-2-phenylacetamide |
| SMILES | CC(C)CCN(C(=O)Cc1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H30ClN3O2/c1-20(2)17-18-32(27(34)19-22-9-5-4-6-10-22)21(3)28-31-26-12-8-7-11-25(26)29(35)33(28)24-15-13-23(30)14-16-24/h4-16,20-21H,17-19H2,1-3H3 |
| InChIKey | LWKDEEISDVBEDA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |