C31H43N3O2 — CID 5030431
N-(3-methylbutyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]nonanamide (PubChem CID 5030431) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]nonanamide.
| Compound Name | N-(3-methylbutyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]nonanamide |
|---|---|
| PubChem CID | 5030431 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-(3-methylbutyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCC(C)C)C(C)c1nc2ccccc2c(=O)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C31H43N3O2/c1-6-7-8-9-10-11-16-29(35)33(22-21-23(2)3)25(5)30-32-28-15-13-12-14-27(28)31(36)34(30)26-19-17-24(4)18-20-26/h12-15,17-20,23,25H,6-11,16,21-22H2,1-5H3 |
| InChIKey | ZMCSSNBZJZDTQJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|