C29H38FN3O2 — CID 42716390
N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylheptanamide (PubChem CID 42716390) has the molecular formula C29H38FN3O2 and a molecular weight of 479.64 g/mol. Its IUPAC name is N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylheptanamide.
| Compound Name | N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylheptanamide |
|---|---|
| PubChem CID | 42716390 |
| Molecular Formula | C29H38FN3O2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylheptanamide |
| SMILES | CCCCCCC(=O)N(CCCCCC)C(C)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H38FN3O2/c1-4-6-8-10-16-27(34)32(21-13-9-7-5-2)22(3)28-31-26-15-12-11-14-25(26)29(35)33(28)24-19-17-23(30)18-20-24/h11-12,14-15,17-20,22H,4-10,13,16,21H2,1-3H3 |
| InChIKey | TUSSTKCKKSNOFY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|