C30H41N3O2 — CID 11612608
N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnonanamide (PubChem CID 11612608) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnonanamide.
| Compound Name | N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnonanamide |
|---|---|
| PubChem CID | 11612608 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCCC)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H41N3O2/c1-4-6-8-9-10-14-22-28(34)32(23-17-7-5-2)24(3)29-31-27-21-16-15-20-26(27)30(35)33(29)25-18-12-11-13-19-25/h11-13,15-16,18-21,24H,4-10,14,17,22-23H2,1-3H3 |
| InChIKey | NMFMNJLEGAFZLI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|