C28H37N3O2 — CID 42719458
N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylpentanamide (PubChem CID 42719458) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylpentanamide.
| Compound Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylpentanamide |
|---|---|
| PubChem CID | 42719458 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylpentanamide |
| SMILES | CCCCCN(C(=O)CCCC)C(C)c1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H37N3O2/c1-6-8-12-18-30(26(32)15-9-7-2)22(5)27-29-25-14-11-10-13-24(25)28(33)31(27)23-17-16-20(3)21(4)19-23/h10-11,13-14,16-17,19,22H,6-9,12,15,18H2,1-5H3 |
| InChIKey | XYAGZSXLPUCXOU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|