C19H21ClN3O2+ — CID 7201794
[(1S)-1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium (PubChem CID 7201794) has the molecular formula C19H21ClN3O2+ and a molecular weight of 358.85 g/mol. Its IUPAC name is [(1S)-1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium.
| Compound Name | [(1S)-1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7201794 |
| Molecular Formula | C19H21ClN3O2+ |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(1S)-1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+][C@@H](C)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-13(21-10-11-25-2)18-22-17-9-4-3-8-16(17)19(24)23(18)15-7-5-6-14(20)12-15/h3-9,12-13,21H,10-11H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | QBIDKITYLZXNMA-ZDUSSCGKSA-O |
| XLogP | 2.31 |
| TPSA | 60.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|