C20H22ClN3O — CID 7288970
3-(3-chlorophenyl)-2-[(1R)-1-(propylamino)propyl]quinazolin-4-one (PubChem CID 7288970) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-[(1R)-1-(propylamino)propyl]quinazolin-4-one.
| Compound Name | 3-(3-chlorophenyl)-2-[(1R)-1-(propylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7288970 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(3-chlorophenyl)-2-[(1R)-1-(propylamino)propyl]quinazolin-4-one |
| SMILES | CCCN[C@H](CC)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O/c1-3-12-22-17(4-2)19-23-18-11-6-5-10-16(18)20(25)24(19)15-9-7-8-14(21)13-15/h5-11,13,17,22H,3-4,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | UJCPRHMOLMFFQL-QGZVFWFLSA-N |
| XLogP | 4.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |