C24H31N3O — CID 7201744
3-(4-ethylphenyl)-2-[(1S)-1-(pentylamino)propyl]quinazolin-4-one (PubChem CID 7201744) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-[(1S)-1-(pentylamino)propyl]quinazolin-4-one.
| Compound Name | 3-(4-ethylphenyl)-2-[(1S)-1-(pentylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7201744 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 3-(4-ethylphenyl)-2-[(1S)-1-(pentylamino)propyl]quinazolin-4-one |
| SMILES | CCCCCN[C@@H](CC)c1nc2ccccc2c(=O)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H31N3O/c1-4-7-10-17-25-21(6-3)23-26-22-12-9-8-11-20(22)24(28)27(23)19-15-13-18(5-2)14-16-19/h8-9,11-16,21,25H,4-7,10,17H2,1-3H3/t21-/m0/s1 |
| InChIKey | CPIJULHKWCDZHW-NRFANRHFSA-N |
| XLogP | 5.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|