C24H29N3O2 — CID 42721715
N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylpentanamide (PubChem CID 42721715) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylpentanamide.
| Compound Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 42721715 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylpentanamide |
| SMILES | CCCCC(=O)N(C)C(C)c1nc2ccccc2c(=O)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-5-7-12-22(28)26(4)17(3)23-25-21-11-9-8-10-20(21)24(29)27(23)19-15-13-18(6-2)14-16-19/h8-11,13-17H,5-7,12H2,1-4H3 |
| InChIKey | QSOQUSJSNAGFIU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |