C25H31N3O2 — CID 42721726
N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylhexanamide (PubChem CID 42721726) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylhexanamide.
| Compound Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 42721726 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylhexanamide |
| SMILES | CCCCCC(=O)N(C)C(C)c1nc2ccccc2c(=O)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-5-7-8-13-23(29)27(4)18(3)24-26-22-12-10-9-11-21(22)25(30)28(24)20-16-14-19(6-2)15-17-20/h9-12,14-18H,5-8,13H2,1-4H3 |
| InChIKey | ALCYUOJNPZHYTG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|