C20H31N3O2 — CID 7226539
2-[(1R)-1-(hexylamino)propyl]-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 7226539) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[(1R)-1-(hexylamino)propyl]-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(hexylamino)propyl]-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7226539 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-[(1R)-1-(hexylamino)propyl]-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | CCCCCCN[C@H](CC)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C20H31N3O2/c1-4-6-7-10-13-21-17(5-2)19-22-18-12-9-8-11-16(18)20(24)23(19)14-15-25-3/h8-9,11-12,17,21H,4-7,10,13-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | RDTXAZXUXSRTRD-QGZVFWFLSA-N |
| XLogP | 3.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|