C19H28ClN3O — CID 7415245
7-chloro-3-ethyl-2-[(1R)-1-(hexylamino)propyl]quinazolin-4-one (PubChem CID 7415245) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is 7-chloro-3-ethyl-2-[(1R)-1-(hexylamino)propyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-ethyl-2-[(1R)-1-(hexylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7415245 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 7-chloro-3-ethyl-2-[(1R)-1-(hexylamino)propyl]quinazolin-4-one |
| SMILES | CCCCCCN[C@H](CC)c1nc2cc(Cl)ccc2c(=O)n1CC |
| InChI | InChI=1S/C19H28ClN3O/c1-4-7-8-9-12-21-16(5-2)18-22-17-13-14(20)10-11-15(17)19(24)23(18)6-3/h10-11,13,16,21H,4-9,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | HALBDOPREIINPG-MRXNPFEDSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|