C15H21ClN3O2+ — CID 7144752
[(1S)-1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-(2-methoxyethyl)azanium (PubChem CID 7144752) has the molecular formula C15H21ClN3O2+ and a molecular weight of 310.81 g/mol. Its IUPAC name is [(1S)-1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-(2-methoxyethyl)azanium.
| Compound Name | [(1S)-1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7144752 |
| Molecular Formula | C15H21ClN3O2+ |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [(1S)-1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-(2-methoxyethyl)azanium |
| SMILES | CCn1c([C@H](C)[NH2+]CCOC)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C15H20ClN3O2/c1-4-19-14(10(2)17-7-8-21-3)18-13-9-11(16)5-6-12(13)15(19)20/h5-6,9-10,17H,4,7-8H2,1-3H3/p+1/t10-/m0/s1 |
| InChIKey | BNACCCLQUCLGQV-JTQLQIEISA-O |
| XLogP | 1.34 |
| TPSA | 60.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|