C23H27ClN4O3 — CID 42712900
1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-ethyl-3-(4-methoxyphenyl)urea (PubChem CID 42712900) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-ethyl-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-ethyl-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42712900 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-1-ethyl-3-(4-methoxyphenyl)urea |
| SMILES | CCC(c1nc2cc(Cl)ccc2c(=O)n1CC)N(CC)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27ClN4O3/c1-5-20(27(6-2)23(30)25-16-9-11-17(31-4)12-10-16)21-26-19-14-15(24)8-13-18(19)22(29)28(21)7-3/h8-14,20H,5-7H2,1-4H3,(H,25,30) |
| InChIKey | NUZOATMSACLUTB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |