C29H31ClN4O2 — CID 42713065
1-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-3-(4-ethylphenyl)urea (PubChem CID 42713065) has the molecular formula C29H31ClN4O2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 1-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-3-(4-ethylphenyl)urea.
| Compound Name | 1-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 42713065 |
| Molecular Formula | C29H31ClN4O2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-benzyl-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)propyl]-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)N(Cc2ccccc2)C(CC)c2nc3cc(Cl)ccc3c(=O)n2CC)cc1 |
| InChI | InChI=1S/C29H31ClN4O2/c1-4-20-12-15-23(16-13-20)31-29(36)34(19-21-10-8-7-9-11-21)26(5-2)27-32-25-18-22(30)14-17-24(25)28(35)33(27)6-3/h7-18,26H,4-6,19H2,1-3H3,(H,31,36) |
| InChIKey | UJLVZRHFJIDQJC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |