C26H24BrClN4O2 — CID 42657422
1-benzyl-3-(2-bromophenyl)-1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]urea (PubChem CID 42657422) has the molecular formula C26H24BrClN4O2 and a molecular weight of 539.86 g/mol. Its IUPAC name is 1-benzyl-3-(2-bromophenyl)-1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]urea.
| Compound Name | 1-benzyl-3-(2-bromophenyl)-1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 42657422 |
| Molecular Formula | C26H24BrClN4O2 |
| Molecular Weight | 539.86 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 1-benzyl-3-(2-bromophenyl)-1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]urea |
| SMILES | CCn1c(C(C)N(Cc2ccccc2)C(=O)Nc2ccccc2Br)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C26H24BrClN4O2/c1-3-31-24(29-22-14-13-19(28)15-20(22)25(31)33)17(2)32(16-18-9-5-4-6-10-18)26(34)30-23-12-8-7-11-21(23)27/h4-15,17H,3,16H2,1-2H3,(H,30,34) |
| InChIKey | CEOSLPZYHOAOHD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.86 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |