C20H20ClFN4O2 — CID 42715157
1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-3-(2-fluorophenyl)-1-methylurea (PubChem CID 42715157) has the molecular formula C20H20ClFN4O2 and a molecular weight of 402.86 g/mol. Its IUPAC name is 1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-3-(2-fluorophenyl)-1-methylurea.
| Compound Name | 1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-3-(2-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 42715157 |
| Molecular Formula | C20H20ClFN4O2 |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-3-(2-fluorophenyl)-1-methylurea |
| SMILES | CCn1c(C(C)N(C)C(=O)Nc2ccccc2F)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C20H20ClFN4O2/c1-4-26-18(23-16-10-9-13(21)11-14(16)19(26)27)12(2)25(3)20(28)24-17-8-6-5-7-15(17)22/h5-12H,4H2,1-3H3,(H,24,28) |
| InChIKey | KOYGDWRSWCJZQG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |