C20H20BrClN4O2 — CID 42713826
3-(3-bromophenyl)-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-1-methylurea (PubChem CID 42713826) has the molecular formula C20H20BrClN4O2 and a molecular weight of 463.76 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-1-methylurea.
| Compound Name | 3-(3-bromophenyl)-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 42713826 |
| Molecular Formula | C20H20BrClN4O2 |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 3-(3-bromophenyl)-1-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-1-methylurea |
| SMILES | CCn1c(C(C)N(C)C(=O)Nc2cccc(Br)c2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H20BrClN4O2/c1-4-26-18(24-17-11-14(22)8-9-16(17)19(26)27)12(2)25(3)20(28)23-15-7-5-6-13(21)10-15/h5-12H,4H2,1-3H3,(H,23,28) |
| InChIKey | GWVJZEJBBFIVSL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |